C29H30F5NO2 — CID 10311556
1-cyclopropyl-2-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-(3-propan-2-ylphenoxy)anilino]ethanol (PubChem CID 10311556) has the molecular formula C29H30F5NO2 and a molecular weight of 519.55 g/mol. Its IUPAC name is 1-cyclopropyl-2-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-(3-propan-2-ylphenoxy)anilino]ethanol.
| Compound Name | 1-cyclopropyl-2-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-(3-propan-2-ylphenoxy)anilino]ethanol |
|---|---|
| PubChem CID | 10311556 |
| Molecular Formula | C29H30F5NO2 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 1-cyclopropyl-2-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-(3-propan-2-ylphenoxy)anilino]ethanol |
| SMILES | CC(C)c1cccc(Oc2cccc(N(Cc3cccc(C(F)(F)C(F)(F)F)c3)CC(O)C3CC3)c2)c1 |
| InChI | InChI=1S/C29H30F5NO2/c1-19(2)22-7-4-10-25(15-22)37-26-11-5-9-24(16-26)35(18-27(36)21-12-13-21)17-20-6-3-8-23(14-20)28(30,31)29(32,33)34/h3-11,14-16,19,21,27,36H,12-13,17-18H2,1-2H3 |
| InChIKey | NROWVFPBOQUBSC-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|