C26H20F11NO3 — CID 10167660
1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[[3-(trifluoromethoxy)phenyl]methoxy]anilino]propan-2-ol (PubChem CID 10167660) has the molecular formula C26H20F11NO3 and a molecular weight of 603.43 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[[3-(trifluoromethoxy)phenyl]methoxy]anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[[3-(trifluoromethoxy)phenyl]methoxy]anilino]propan-2-ol |
|---|---|
| PubChem CID | 10167660 |
| Molecular Formula | C26H20F11NO3 |
| Molecular Weight | 603.43 g/mol |
| Exact Mass | 603.13 |
| IUPAC Name | 1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-3-[[3-(trifluoromethoxy)phenyl]methoxy]anilino]propan-2-ol |
| SMILES | OC(CN(Cc1cccc(C(F)(F)C(F)(F)F)c1)c1cccc(OCc2cccc(OC(F)(F)F)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C26H20F11NO3/c27-23(28,25(32,33)34)18-6-1-4-16(10-18)13-38(14-22(39)24(29,30)31)19-7-3-8-20(12-19)40-15-17-5-2-9-21(11-17)41-26(35,36)37/h1-12,22,39H,13-15H2 |
| InChIKey | JXIJYGKAJOIFQA-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.43 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|