C24H16F11NO3 — CID 10348119
1,1,1-trifluoro-3-[N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-[3-(trifluoromethoxy)phenoxy]anilino]propan-2-ol (PubChem CID 10348119) has the molecular formula C24H16F11NO3 and a molecular weight of 575.37 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-[3-(trifluoromethoxy)phenoxy]anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-[3-(trifluoromethoxy)phenoxy]anilino]propan-2-ol |
|---|---|
| PubChem CID | 10348119 |
| Molecular Formula | C24H16F11NO3 |
| Molecular Weight | 575.37 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | 1,1,1-trifluoro-3-[N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-[3-(trifluoromethoxy)phenoxy]anilino]propan-2-ol |
| SMILES | OC(CN(c1cccc(Oc2cccc(OC(F)(F)F)c2)c1)c1cccc(C(F)(F)C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C24H16F11NO3/c25-21(26,23(30,31)32)14-4-1-5-15(10-14)36(13-20(37)22(27,28)29)16-6-2-7-17(11-16)38-18-8-3-9-19(12-18)39-24(33,34)35/h1-12,20,37H,13H2 |
| InChIKey | WQJCRNJMRVKWTQ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.37 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|