C26H17F14NO4 — CID 10283314
1,1,1-trifluoro-3-[N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]anilino]propan-2-ol (PubChem CID 10283314) has the molecular formula C26H17F14NO4 and a molecular weight of 673.40 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]anilino]propan-2-ol |
|---|---|
| PubChem CID | 10283314 |
| Molecular Formula | C26H17F14NO4 |
| Molecular Weight | 673.40 g/mol |
| Exact Mass | 673.09 |
| IUPAC Name | 1,1,1-trifluoro-3-[N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]anilino]propan-2-ol |
| SMILES | OC(CN(Oc1cccc(C(F)(F)C(F)(F)C(F)(F)F)c1)c1cccc(Oc2cccc(OC(F)(F)C(F)F)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C26H17F14NO4/c27-21(28)24(34,35)44-18-8-3-7-17(12-18)43-16-6-2-5-15(11-16)41(13-20(42)23(31,32)33)45-19-9-1-4-14(10-19)22(29,30)25(36,37)26(38,39)40/h1-12,20-21,42H,13H2 |
| InChIKey | ZBDFKNLNBQFHPM-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.40 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|