C17H15F6NO3 — CID 58716455
(2R)-1,1,1-trifluoro-3-(3-methyl-N-[3-(trifluoromethoxy)phenoxy]anilino)propan-2-ol (PubChem CID 58716455) has the molecular formula C17H15F6NO3 and a molecular weight of 395.30 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-(3-methyl-N-[3-(trifluoromethoxy)phenoxy]anilino)propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-(3-methyl-N-[3-(trifluoromethoxy)phenoxy]anilino)propan-2-ol |
|---|---|
| PubChem CID | 58716455 |
| Molecular Formula | C17H15F6NO3 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-(3-methyl-N-[3-(trifluoromethoxy)phenoxy]anilino)propan-2-ol |
| SMILES | Cc1cccc(N(C[C@@H](O)C(F)(F)F)Oc2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H15F6NO3/c1-11-4-2-5-12(8-11)24(10-15(25)16(18,19)20)27-14-7-3-6-13(9-14)26-17(21,22)23/h2-9,15,25H,10H2,1H3/t15-/m1/s1 |
| InChIKey | VNQUWZMJCAEXBX-OAHLLOKOSA-N |
| XLogP | 4.62 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|