C24H23F6NO3 — CID 91375218
ethane;(2R)-1,1,1-trifluoro-3-(3-phenoxy-N-[3-(trifluoromethyl)phenoxy]anilino)propan-2-ol (PubChem CID 91375218) has the molecular formula C24H23F6NO3 and a molecular weight of 487.44 g/mol. Its IUPAC name is ethane;(2R)-1,1,1-trifluoro-3-(3-phenoxy-N-[3-(trifluoromethyl)phenoxy]anilino)propan-2-ol.
| Compound Name | ethane;(2R)-1,1,1-trifluoro-3-(3-phenoxy-N-[3-(trifluoromethyl)phenoxy]anilino)propan-2-ol |
|---|---|
| PubChem CID | 91375218 |
| Molecular Formula | C24H23F6NO3 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | ethane;(2R)-1,1,1-trifluoro-3-(3-phenoxy-N-[3-(trifluoromethyl)phenoxy]anilino)propan-2-ol |
| SMILES | CC.O[C@H](CN(Oc1cccc(C(F)(F)F)c1)c1cccc(Oc2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C22H17F6NO3.C2H6/c23-21(24,25)15-6-4-11-19(12-15)32-29(14-20(30)22(26,27)28)16-7-5-10-18(13-16)31-17-8-2-1-3-9-17;1-2/h1-13,20,30H,14H2;1-2H3/t20-;/m1./s1 |
| InChIKey | NMMHJZMKNGNKTP-VEIFNGETSA-N |
| XLogP | 7.25 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|