C25H16F13NO3 — CID 10290109
(2S)-1,1,1-trifluoro-3-[N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]-3-[3-(trifluoromethyl)phenoxy]anilino]propan-2-ol (PubChem CID 10290109) has the molecular formula C25H16F13NO3 and a molecular weight of 625.38 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-3-[N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]-3-[3-(trifluoromethyl)phenoxy]anilino]propan-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-3-[N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]-3-[3-(trifluoromethyl)phenoxy]anilino]propan-2-ol |
|---|---|
| PubChem CID | 10290109 |
| Molecular Formula | C25H16F13NO3 |
| Molecular Weight | 625.38 g/mol |
| Exact Mass | 625.09 |
| IUPAC Name | (2S)-1,1,1-trifluoro-3-[N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]-3-[3-(trifluoromethyl)phenoxy]anilino]propan-2-ol |
| SMILES | O[C@@H](CN(Oc1cccc(C(F)(F)C(F)(F)C(F)(F)F)c1)c1cccc(Oc2cccc(C(F)(F)F)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C25H16F13NO3/c26-21(27,24(34,35)25(36,37)38)14-4-1-9-19(10-14)42-39(13-20(40)23(31,32)33)16-6-3-8-18(12-16)41-17-7-2-5-15(11-17)22(28,29)30/h1-12,20,40H,13H2/t20-/m0/s1 |
| InChIKey | HZVACBVVMBNXBG-FQEVSTJZSA-N |
| XLogP | 8.51 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.38 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|