C23H16F8N2O4S — CID 10153062
(2S)-1,1,1-trifluoro-3-[3-(4-nitrophenyl)sulfanyl-N-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]anilino]propan-2-ol (PubChem CID 10153062) has the molecular formula C23H16F8N2O4S and a molecular weight of 568.44 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-3-[3-(4-nitrophenyl)sulfanyl-N-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]anilino]propan-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-3-[3-(4-nitrophenyl)sulfanyl-N-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]anilino]propan-2-ol |
|---|---|
| PubChem CID | 10153062 |
| Molecular Formula | C23H16F8N2O4S |
| Molecular Weight | 568.44 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | (2S)-1,1,1-trifluoro-3-[3-(4-nitrophenyl)sulfanyl-N-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]anilino]propan-2-ol |
| SMILES | O=[N+]([O-])c1ccc(Sc2cccc(N(C[C@H](O)C(F)(F)F)Oc3cccc(C(F)(F)C(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C23H16F8N2O4S/c24-21(25,23(29,30)31)14-3-1-5-17(11-14)37-32(13-20(34)22(26,27)28)16-4-2-6-19(12-16)38-18-9-7-15(8-10-18)33(35)36/h1-12,20,34H,13H2/t20-/m0/s1 |
| InChIKey | XKTJWMFEJMODEU-FQEVSTJZSA-N |
| XLogP | 7.12 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.44 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|