C23H15Cl2F8NO2 — CID 10460441
3-[3-(3,4-dichlorophenoxy)-N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]anilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 10460441) has the molecular formula C23H15Cl2F8NO2 and a molecular weight of 560.27 g/mol. Its IUPAC name is 3-[3-(3,4-dichlorophenoxy)-N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]anilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[3-(3,4-dichlorophenoxy)-N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]anilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 10460441 |
| Molecular Formula | C23H15Cl2F8NO2 |
| Molecular Weight | 560.27 g/mol |
| Exact Mass | 559.04 |
| IUPAC Name | 3-[3-(3,4-dichlorophenoxy)-N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]anilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(CN(c1cccc(Oc2ccc(Cl)c(Cl)c2)c1)c1cccc(C(F)(F)C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C23H15Cl2F8NO2/c24-18-8-7-17(11-19(18)25)36-16-6-2-5-15(10-16)34(12-20(35)22(28,29)30)14-4-1-3-13(9-14)21(26,27)23(31,32)33/h1-11,20,35H,12H2 |
| InChIKey | MLYHURMFPCVYLZ-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.27 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|