C25H21F8NO2 — CID 10075327
3-[3-(3,5-dimethylphenoxy)-N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]anilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 10075327) has the molecular formula C25H21F8NO2 and a molecular weight of 519.43 g/mol. Its IUPAC name is 3-[3-(3,5-dimethylphenoxy)-N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]anilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[3-(3,5-dimethylphenoxy)-N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]anilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 10075327 |
| Molecular Formula | C25H21F8NO2 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 3-[3-(3,5-dimethylphenoxy)-N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]anilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | Cc1cc(C)cc(Oc2cccc(N(CC(O)C(F)(F)F)c3cccc(C(F)(F)C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C25H21F8NO2/c1-15-9-16(2)11-21(10-15)36-20-8-4-7-19(13-20)34(14-22(35)24(28,29)30)18-6-3-5-17(12-18)23(26,27)25(31,32)33/h3-13,22,35H,14H2,1-2H3 |
| InChIKey | RLUQMRGCHVHEBN-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|