C26H21F10NO3 — CID 10145009
3-[3-(3-ethylphenoxy)-N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]anilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 10145009) has the molecular formula C26H21F10NO3 and a molecular weight of 585.44 g/mol. Its IUPAC name is 3-[3-(3-ethylphenoxy)-N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]anilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[3-(3-ethylphenoxy)-N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]anilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 10145009 |
| Molecular Formula | C26H21F10NO3 |
| Molecular Weight | 585.44 g/mol |
| Exact Mass | 585.14 |
| IUPAC Name | 3-[3-(3-ethylphenoxy)-N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]anilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCc1cccc(Oc2cccc(N(CC(O)C(F)(F)F)Oc3cccc(C(F)(F)C(F)(F)C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C26H21F10NO3/c1-2-16-6-3-9-19(12-16)39-20-10-5-8-18(14-20)37(15-22(38)24(29,30)31)40-21-11-4-7-17(13-21)23(27,28)25(32,33)26(34,35)36/h3-14,22,38H,2,15H2,1H3 |
| InChIKey | MCWNADYJNDQYDS-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.44 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|