C26H23F8NO3 — CID 10311866
(2S)-3-[3-[(4-ethylphenyl)methoxy]-N-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]anilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 10311866) has the molecular formula C26H23F8NO3 and a molecular weight of 549.46 g/mol. Its IUPAC name is (2S)-3-[3-[(4-ethylphenyl)methoxy]-N-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]anilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-3-[3-[(4-ethylphenyl)methoxy]-N-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]anilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 10311866 |
| Molecular Formula | C26H23F8NO3 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | (2S)-3-[3-[(4-ethylphenyl)methoxy]-N-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]anilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCc1ccc(COc2cccc(N(C[C@H](O)C(F)(F)F)Oc3cccc(C(F)(F)C(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C26H23F8NO3/c1-2-17-9-11-18(12-10-17)16-37-21-7-4-6-20(14-21)35(15-23(36)25(29,30)31)38-22-8-3-5-19(13-22)24(27,28)26(32,33)34/h3-14,23,36H,2,15-16H2,1H3/t23-/m0/s1 |
| InChIKey | WEHYFAKHBRRYSM-QHCPKHFHSA-N |
| XLogP | 7.21 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|