C23H17F8NO3 — CID 59040118
(2R)-1,1,1-trifluoro-3-(N-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]-3-phenoxyanilino)propan-2-ol (PubChem CID 59040118) has the molecular formula C23H17F8NO3 and a molecular weight of 507.38 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-(N-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]-3-phenoxyanilino)propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-(N-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]-3-phenoxyanilino)propan-2-ol |
|---|---|
| PubChem CID | 59040118 |
| Molecular Formula | C23H17F8NO3 |
| Molecular Weight | 507.38 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-(N-[3-(1,1,2,2,2-pentafluoroethyl)phenoxy]-3-phenoxyanilino)propan-2-ol |
| SMILES | O[C@H](CN(Oc1cccc(C(F)(F)C(F)(F)F)c1)c1cccc(Oc2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C23H17F8NO3/c24-21(25,23(29,30)31)15-6-4-11-19(12-15)35-32(14-20(33)22(26,27)28)16-7-5-10-18(13-16)34-17-8-2-1-3-9-17/h1-13,20,33H,14H2/t20-/m1/s1 |
| InChIKey | CAHVNXZUNXXSDE-HXUWFJFHSA-N |
| XLogP | 6.86 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.38 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|