C25H21F8NO2 — CID 10481755
1,1,1-trifluoro-3-[N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-(2-phenylethoxy)anilino]propan-2-ol (PubChem CID 10481755) has the molecular formula C25H21F8NO2 and a molecular weight of 519.43 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-(2-phenylethoxy)anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-(2-phenylethoxy)anilino]propan-2-ol |
|---|---|
| PubChem CID | 10481755 |
| Molecular Formula | C25H21F8NO2 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 1,1,1-trifluoro-3-[N-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-3-(2-phenylethoxy)anilino]propan-2-ol |
| SMILES | OC(CN(c1cccc(OCCc2ccccc2)c1)c1cccc(C(F)(F)C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C25H21F8NO2/c26-23(27,25(31,32)33)18-8-4-9-19(14-18)34(16-22(35)24(28,29)30)20-10-5-11-21(15-20)36-13-12-17-6-2-1-3-7-17/h1-11,14-15,22,35H,12-13,16H2 |
| InChIKey | CJGSKOQQNDEPFF-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|