C26H17F14NO3 — CID 10189842
1,1,1-trifluoro-3-[3-[[3-fluoro-5-(trifluoromethyl)phenyl]methoxy]-N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]anilino]propan-2-ol (PubChem CID 10189842) has the molecular formula C26H17F14NO3 and a molecular weight of 657.40 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[3-[[3-fluoro-5-(trifluoromethyl)phenyl]methoxy]-N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[3-[[3-fluoro-5-(trifluoromethyl)phenyl]methoxy]-N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]anilino]propan-2-ol |
|---|---|
| PubChem CID | 10189842 |
| Molecular Formula | C26H17F14NO3 |
| Molecular Weight | 657.40 g/mol |
| Exact Mass | 657.10 |
| IUPAC Name | 1,1,1-trifluoro-3-[3-[[3-fluoro-5-(trifluoromethyl)phenyl]methoxy]-N-[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]anilino]propan-2-ol |
| SMILES | OC(CN(Oc1cccc(C(F)(F)C(F)(F)C(F)(F)F)c1)c1cccc(OCc2cc(F)cc(C(F)(F)F)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C26H17F14NO3/c27-17-8-14(7-16(9-17)23(30,31)32)13-43-19-5-2-4-18(11-19)41(12-21(42)24(33,34)35)44-20-6-1-3-15(10-20)22(28,29)25(36,37)26(38,39)40/h1-11,21,42H,12-13H2 |
| InChIKey | ZPCHLHWJXSWUOE-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.40 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|