C26H17ClF13NO2 — CID 10168550
(2R)-3-[3-[4-chloro-3-(trifluoromethyl)phenoxy]-N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 10168550) has the molecular formula C26H17ClF13NO2 and a molecular weight of 657.85 g/mol. Its IUPAC name is (2R)-3-[3-[4-chloro-3-(trifluoromethyl)phenoxy]-N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2R)-3-[3-[4-chloro-3-(trifluoromethyl)phenoxy]-N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 10168550 |
| Molecular Formula | C26H17ClF13NO2 |
| Molecular Weight | 657.85 g/mol |
| Exact Mass | 657.07 |
| IUPAC Name | (2R)-3-[3-[4-chloro-3-(trifluoromethyl)phenoxy]-N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]anilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | O[C@H](CN(Cc1cccc(C(F)(F)C(F)(F)C(F)(F)F)c1)c1cccc(Oc2ccc(Cl)c(C(F)(F)F)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C26H17ClF13NO2/c27-20-8-7-18(11-19(20)23(30,31)32)43-17-6-2-5-16(10-17)41(13-21(42)24(33,34)35)12-14-3-1-4-15(9-14)22(28,29)25(36,37)26(38,39)40/h1-11,21,42H,12-13H2/t21-/m1/s1 |
| InChIKey | BOTFWALRRFIFLJ-OAQYLSRUSA-N |
| XLogP | 9.37 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.85 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|