C26H26F11NO3 — CID 22038585
1,1,1-trifluoro-3-[N-[[1-(1,1,2,2,2-pentafluoroethyl)cyclohexyl]methyl]-3-[[3-(trifluoromethoxy)phenyl]methoxy]anilino]propan-2-ol (PubChem CID 22038585) has the molecular formula C26H26F11NO3 and a molecular weight of 609.48 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[N-[[1-(1,1,2,2,2-pentafluoroethyl)cyclohexyl]methyl]-3-[[3-(trifluoromethoxy)phenyl]methoxy]anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[N-[[1-(1,1,2,2,2-pentafluoroethyl)cyclohexyl]methyl]-3-[[3-(trifluoromethoxy)phenyl]methoxy]anilino]propan-2-ol |
|---|---|
| PubChem CID | 22038585 |
| Molecular Formula | C26H26F11NO3 |
| Molecular Weight | 609.48 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | 1,1,1-trifluoro-3-[N-[[1-(1,1,2,2,2-pentafluoroethyl)cyclohexyl]methyl]-3-[[3-(trifluoromethoxy)phenyl]methoxy]anilino]propan-2-ol |
| SMILES | OC(CN(CC1(C(F)(F)C(F)(F)F)CCCCC1)c1cccc(OCc2cccc(OC(F)(F)F)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C26H26F11NO3/c27-23(28,29)21(39)14-38(16-22(10-2-1-3-11-22)24(30,31)25(32,33)34)18-7-5-8-19(13-18)40-15-17-6-4-9-20(12-17)41-26(35,36)37/h4-9,12-13,21,39H,1-3,10-11,14-16H2 |
| InChIKey | GIJBCXDVBQPQII-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.48 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|