C26H26F11NO2 — CID 87873277
3-[N-(1-cyclohexyl-2,2,3,3,3-pentafluoropropyl)-3-[[3-(trifluoromethyl)phenyl]methoxy]anilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 87873277) has the molecular formula C26H26F11NO2 and a molecular weight of 593.48 g/mol. Its IUPAC name is 3-[N-(1-cyclohexyl-2,2,3,3,3-pentafluoropropyl)-3-[[3-(trifluoromethyl)phenyl]methoxy]anilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[N-(1-cyclohexyl-2,2,3,3,3-pentafluoropropyl)-3-[[3-(trifluoromethyl)phenyl]methoxy]anilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 87873277 |
| Molecular Formula | C26H26F11NO2 |
| Molecular Weight | 593.48 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | 3-[N-(1-cyclohexyl-2,2,3,3,3-pentafluoropropyl)-3-[[3-(trifluoromethyl)phenyl]methoxy]anilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(CN(c1cccc(OCc2cccc(C(F)(F)F)c2)c1)C(C1CCCCC1)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H26F11NO2/c27-23(28,26(35,36)37)22(17-7-2-1-3-8-17)38(14-21(39)25(32,33)34)19-10-5-11-20(13-19)40-15-16-6-4-9-18(12-16)24(29,30)31/h4-6,9-13,17,21-22,39H,1-3,7-8,14-15H2 |
| InChIKey | XCBKCBNKAMIGOX-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.48 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|