C26H31F6NO3 — CID 87184880
3-[N-[cyclohexyl(trifluoromethoxy)methyl]-3-(3-propan-2-ylphenoxy)anilino]-1,1,1-trifluoropropan-2-ol (PubChem CID 87184880) has the molecular formula C26H31F6NO3 and a molecular weight of 519.53 g/mol. Its IUPAC name is 3-[N-[cyclohexyl(trifluoromethoxy)methyl]-3-(3-propan-2-ylphenoxy)anilino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[N-[cyclohexyl(trifluoromethoxy)methyl]-3-(3-propan-2-ylphenoxy)anilino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 87184880 |
| Molecular Formula | C26H31F6NO3 |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 3-[N-[cyclohexyl(trifluoromethoxy)methyl]-3-(3-propan-2-ylphenoxy)anilino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(C)c1cccc(Oc2cccc(N(CC(O)C(F)(F)F)C(OC(F)(F)F)C3CCCCC3)c2)c1 |
| InChI | InChI=1S/C26H31F6NO3/c1-17(2)19-10-6-12-21(14-19)35-22-13-7-11-20(15-22)33(16-23(34)25(27,28)29)24(36-26(30,31)32)18-8-4-3-5-9-18/h6-7,10-15,17-18,23-24,34H,3-5,8-9,16H2,1-2H3 |
| InChIKey | POWMLILRHBQJMR-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|