C26H21F10NO2 — CID 23378761
1,1,1-trifluoro-3-[N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-ol (PubChem CID 23378761) has the molecular formula C26H21F10NO2 and a molecular weight of 569.44 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-ol |
|---|---|
| PubChem CID | 23378761 |
| Molecular Formula | C26H21F10NO2 |
| Molecular Weight | 569.44 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | 1,1,1-trifluoro-3-[N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]anilino]propan-2-ol |
| SMILES | OC(CN(Cc1cccc(OC(F)(F)C(F)F)c1)c1cccc(Cc2cccc(C(F)(F)F)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C26H21F10NO2/c27-23(28)26(35,36)39-21-9-3-6-18(13-21)14-37(15-22(38)25(32,33)34)20-8-2-5-17(12-20)10-16-4-1-7-19(11-16)24(29,30)31/h1-9,11-13,22-23,38H,10,14-15H2 |
| InChIKey | LCMRHRYMNWEBEL-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.44 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|