C25H18F11NO3 — CID 10281937
(2R)-1,1,1-trifluoro-3-[N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]anilino]propan-2-ol (PubChem CID 10281937) has the molecular formula C25H18F11NO3 and a molecular weight of 589.40 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-[N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]anilino]propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-[N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]anilino]propan-2-ol |
|---|---|
| PubChem CID | 10281937 |
| Molecular Formula | C25H18F11NO3 |
| Molecular Weight | 589.40 g/mol |
| Exact Mass | 589.11 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-[N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-[3-(1,1,2,2-tetrafluoroethoxy)phenoxy]anilino]propan-2-ol |
| SMILES | O[C@H](CN(Cc1cc(C(F)(F)F)ccc1F)c1cccc(Oc2cccc(OC(F)(F)C(F)F)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C25H18F11NO3/c26-20-8-7-15(23(29,30)31)9-14(20)12-37(13-21(38)24(32,33)34)16-3-1-4-17(10-16)39-18-5-2-6-19(11-18)40-25(35,36)22(27)28/h1-11,21-22,38H,12-13H2/t21-/m1/s1 |
| InChIKey | LXISPKPYNQERSU-OAQYLSRUSA-N |
| XLogP | 7.80 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.40 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|