C26H23F8NO2 — CID 59072126
1,1,1-trifluoro-3-[3-[[3-(fluoromethyl)phenyl]methyl]-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol (PubChem CID 59072126) has the molecular formula C26H23F8NO2 and a molecular weight of 533.46 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[3-[[3-(fluoromethyl)phenyl]methyl]-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[3-[[3-(fluoromethyl)phenyl]methyl]-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol |
|---|---|
| PubChem CID | 59072126 |
| Molecular Formula | C26H23F8NO2 |
| Molecular Weight | 533.46 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 1,1,1-trifluoro-3-[3-[[3-(fluoromethyl)phenyl]methyl]-N-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]anilino]propan-2-ol |
| SMILES | OC(CN(Cc1cccc(OC(F)(F)C(F)F)c1)c1cccc(Cc2cccc(CF)c2)c1)C(F)(F)F |
| InChI | InChI=1S/C26H23F8NO2/c27-14-19-6-1-4-17(11-19)10-18-5-2-8-21(12-18)35(16-23(36)25(30,31)32)15-20-7-3-9-22(13-20)37-26(33,34)24(28)29/h1-9,11-13,23-24,36H,10,14-16H2 |
| InChIKey | LJXAMEMVPVDRIP-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.46 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|