C22H23NO3 — CID 70898495
3-[(N-[(2S)-2-hydroxypropyl]-3-phenoxyanilino)methyl]phenol (PubChem CID 70898495) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-[(N-[(2S)-2-hydroxypropyl]-3-phenoxyanilino)methyl]phenol.
| Compound Name | 3-[(N-[(2S)-2-hydroxypropyl]-3-phenoxyanilino)methyl]phenol |
|---|---|
| PubChem CID | 70898495 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 3-[(N-[(2S)-2-hydroxypropyl]-3-phenoxyanilino)methyl]phenol |
| SMILES | C[C@H](O)CN(Cc1cccc(O)c1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H23NO3/c1-17(24)15-23(16-18-7-5-9-20(25)13-18)19-8-6-12-22(14-19)26-21-10-3-2-4-11-21/h2-14,17,24-25H,15-16H2,1H3/t17-/m0/s1 |
| InChIKey | ZSDIKHJXSAPPKX-KRWDZBQOSA-N |
| XLogP | 4.57 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |