C25H23F6NO4 — CID 21301192
1,1,1-trifluoro-2-[3-phenoxy-N-[[3-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]methyl]anilino]propan-2-ol (PubChem CID 21301192) has the molecular formula C25H23F6NO4 and a molecular weight of 515.45 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[3-phenoxy-N-[[3-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]methyl]anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[3-phenoxy-N-[[3-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]methyl]anilino]propan-2-ol |
|---|---|
| PubChem CID | 21301192 |
| Molecular Formula | C25H23F6NO4 |
| Molecular Weight | 515.45 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 1,1,1-trifluoro-2-[3-phenoxy-N-[[3-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]methyl]anilino]propan-2-ol |
| SMILES | CC(O)(N(Cc1cccc(OCC(O)C(F)(F)F)c1)c1cccc(Oc2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C25H23F6NO4/c1-23(34,25(29,30)31)32(18-8-6-12-21(14-18)36-19-9-3-2-4-10-19)15-17-7-5-11-20(13-17)35-16-22(33)24(26,27)28/h2-14,22,33-34H,15-16H2,1H3 |
| InChIKey | RFNKYKAWNLDDOT-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.45 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|