C9H10F3NO2 — CID 63901721
3-(3-aminophenoxy)-1,1,1-trifluoropropan-2-ol (PubChem CID 63901721) has the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. Its IUPAC name is 3-(3-aminophenoxy)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(3-aminophenoxy)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 63901721 |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 3-(3-aminophenoxy)-1,1,1-trifluoropropan-2-ol |
| SMILES | Nc1cccc(OCC(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H10F3NO2/c10-9(11,12)8(14)5-15-7-3-1-2-6(13)4-7/h1-4,8,14H,5,13H2 |
| InChIKey | CEZSFWYSRGVYJV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|