C10H8F3NO2 — CID 63901285
3-(3,3,3-trifluoro-2-hydroxypropoxy)benzonitrile (PubChem CID 63901285) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is 3-(3,3,3-trifluoro-2-hydroxypropoxy)benzonitrile.
| Compound Name | 3-(3,3,3-trifluoro-2-hydroxypropoxy)benzonitrile |
|---|---|
| PubChem CID | 63901285 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 3-(3,3,3-trifluoro-2-hydroxypropoxy)benzonitrile |
| SMILES | N#Cc1cccc(OCC(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F3NO2/c11-10(12,13)9(15)6-16-8-3-1-2-7(4-8)5-14/h1-4,9,15H,6H2 |
| InChIKey | GMGUESOXCCTEEU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |