C16H23NO2 — CID 178167710
3-(2,4-dimethyl-3-oxopentoxy)benzonitrile;ethane (PubChem CID 178167710) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-(2,4-dimethyl-3-oxopentoxy)benzonitrile;ethane.
| Compound Name | 3-(2,4-dimethyl-3-oxopentoxy)benzonitrile;ethane |
|---|---|
| PubChem CID | 178167710 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 3-(2,4-dimethyl-3-oxopentoxy)benzonitrile;ethane |
| SMILES | CC.CC(C)C(=O)C(C)COc1cccc(C#N)c1 |
| InChI | InChI=1S/C14H17NO2.C2H6/c1-10(2)14(16)11(3)9-17-13-6-4-5-12(7-13)8-15;1-2/h4-7,10-11H,9H2,1-3H3;1-2H3 |
| InChIKey | VXARBGGQQITJJN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |