C11H11F3O4 — CID 63899374
2-[3-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]acetic acid (PubChem CID 63899374) has the molecular formula C11H11F3O4 and a molecular weight of 264.20 g/mol. Its IUPAC name is 2-[3-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]acetic acid.
| Compound Name | 2-[3-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 63899374 |
| Molecular Formula | C11H11F3O4 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-[3-(3,3,3-trifluoro-2-hydroxypropoxy)phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(OCC(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3O4/c12-11(13,14)9(15)6-18-8-3-1-2-7(4-8)5-10(16)17/h1-4,9,15H,5-6H2,(H,16,17) |
| InChIKey | IACNQKQQAOPXJT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |