C11H12F2O3 — CID 84693368
2-[3-(2,2-difluoropropoxy)phenyl]acetic acid (PubChem CID 84693368) has the molecular formula C11H12F2O3 and a molecular weight of 230.21 g/mol. Its IUPAC name is 2-[3-(2,2-difluoropropoxy)phenyl]acetic acid.
| Compound Name | 2-[3-(2,2-difluoropropoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 84693368 |
| Molecular Formula | C11H12F2O3 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2-[3-(2,2-difluoropropoxy)phenyl]acetic acid |
| SMILES | CC(F)(F)COc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C11H12F2O3/c1-11(12,13)7-16-9-4-2-3-8(5-9)6-10(14)15/h2-5H,6-7H2,1H3,(H,14,15) |
| InChIKey | MUNFXMQQXSPDIR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |