C19H16F6O5 — CID 11619007
2-[3-[2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]ethoxy]phenyl]acetic acid (PubChem CID 11619007) has the molecular formula C19H16F6O5 and a molecular weight of 438.32 g/mol. Its IUPAC name is 2-[3-[2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]ethoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 11619007 |
| Molecular Formula | C19H16F6O5 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 2-[3-[2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]ethoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(OCCOc2cccc(C(O)(C(F)(F)F)C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H16F6O5/c20-18(21,22)17(28,19(23,24)25)13-4-2-6-15(11-13)30-8-7-29-14-5-1-3-12(9-14)10-16(26)27/h1-6,9,11,28H,7-8,10H2,(H,26,27) |
| InChIKey | KLVOJEKPOCFWRV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|