C20H18F6O5 — CID 141137441
2-[4-[3-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]propoxy]phenyl]acetic acid (PubChem CID 141137441) has the molecular formula C20H18F6O5 and a molecular weight of 452.35 g/mol. Its IUPAC name is 2-[4-[3-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]propoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[3-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 141137441 |
| Molecular Formula | C20H18F6O5 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 2-[4-[3-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenoxy]propoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(OCCCOc2cccc(C(O)(C(F)(F)F)C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H18F6O5/c21-19(22,23)18(29,20(24,25)26)14-3-1-4-16(12-14)31-10-2-9-30-15-7-5-13(6-8-15)11-17(27)28/h1,3-8,12,29H,2,9-11H2,(H,27,28) |
| InChIKey | MRXLOJVUUDFNIW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|