C12H13F3O4 — CID 61492419
2-[4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]acetic acid (PubChem CID 61492419) has the molecular formula C12H13F3O4 and a molecular weight of 278.23 g/mol. Its IUPAC name is 2-[4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 61492419 |
| Molecular Formula | C12H13F3O4 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-[4-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(OCCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3O4/c13-12(14,15)8-18-5-6-19-10-3-1-9(2-4-10)7-11(16)17/h1-4H,5-8H2,(H,16,17) |
| InChIKey | CCRYVKMNPFZJLT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|