C14H19F3O3 — CID 115495880
1-[4-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]propan-2-ol (PubChem CID 115495880) has the molecular formula C14H19F3O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is 1-[4-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]propan-2-ol.
| Compound Name | 1-[4-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 115495880 |
| Molecular Formula | C14H19F3O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1-[4-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]propan-2-ol |
| SMILES | CC(O)Cc1ccc(OCCCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3O3/c1-11(18)9-12-3-5-13(6-4-12)20-8-2-7-19-10-14(15,16)17/h3-6,11,18H,2,7-10H2,1H3 |
| InChIKey | QJDJQEPADACXBX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|