C14H19F3O2 — CID 64766053
1-propan-2-yl-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzene (PubChem CID 64766053) has the molecular formula C14H19F3O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 1-propan-2-yl-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzene.
| Compound Name | 1-propan-2-yl-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzene |
|---|---|
| PubChem CID | 64766053 |
| Molecular Formula | C14H19F3O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-propan-2-yl-4-[3-(2,2,2-trifluoroethoxy)propoxy]benzene |
| SMILES | CC(C)c1ccc(OCCCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3O2/c1-11(2)12-4-6-13(7-5-12)19-9-3-8-18-10-14(15,16)17/h4-7,11H,3,8-10H2,1-2H3 |
| InChIKey | LCIASEWWFDPSCR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|