C14H17F5O — CID 129166789
1-(4,4,5,5,5-pentafluoropentoxy)-4-propan-2-ylbenzene (PubChem CID 129166789) has the molecular formula C14H17F5O and a molecular weight of 296.28 g/mol. Its IUPAC name is 1-(4,4,5,5,5-pentafluoropentoxy)-4-propan-2-ylbenzene.
| Compound Name | 1-(4,4,5,5,5-pentafluoropentoxy)-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 129166789 |
| Molecular Formula | C14H17F5O |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 1-(4,4,5,5,5-pentafluoropentoxy)-4-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc(OCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F5O/c1-10(2)11-4-6-12(7-5-11)20-9-3-8-13(15,16)14(17,18)19/h4-7,10H,3,8-9H2,1-2H3 |
| InChIKey | AAUHPEJBHXDBIU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|