C12H10F5NO — CID 98041773
4-(4,4,5,5,5-pentafluoropentoxy)benzonitrile (PubChem CID 98041773) has the molecular formula C12H10F5NO and a molecular weight of 279.21 g/mol. Its IUPAC name is 4-(4,4,5,5,5-pentafluoropentoxy)benzonitrile.
| Compound Name | 4-(4,4,5,5,5-pentafluoropentoxy)benzonitrile |
|---|---|
| PubChem CID | 98041773 |
| Molecular Formula | C12H10F5NO |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 4-(4,4,5,5,5-pentafluoropentoxy)benzonitrile |
| SMILES | N#Cc1ccc(OCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10F5NO/c13-11(14,12(15,16)17)6-1-7-19-10-4-2-9(8-18)3-5-10/h2-5H,1,6-7H2 |
| InChIKey | STNZXQMBXVAHLP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|