C32H26F10N2O2 — CID 132565552
4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-[4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-pyridinyl]pyridine (PubChem CID 132565552) has the molecular formula C32H26F10N2O2 and a molecular weight of 660.55 g/mol. Its IUPAC name is 4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-[4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-pyridinyl]pyridine.
| Compound Name | 4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-[4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-pyridinyl]pyridine |
|---|---|
| PubChem CID | 132565552 |
| Molecular Formula | C32H26F10N2O2 |
| Molecular Weight | 660.55 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | 4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-[4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]-2-pyridinyl]pyridine |
| SMILES | FC(F)(F)C(F)(F)CCCOc1ccc(-c2ccnc(-c3cc(-c4ccc(OCCCC(F)(F)C(F)(F)F)cc4)ccn3)c2)cc1 |
| InChI | InChI=1S/C32H26F10N2O2/c33-29(34,31(37,38)39)13-1-17-45-25-7-3-21(4-8-25)23-11-15-43-27(19-23)28-20-24(12-16-44-28)22-5-9-26(10-6-22)46-18-2-14-30(35,36)32(40,41)42/h3-12,15-16,19-20H,1-2,13-14,17-18H2 |
| InChIKey | GPSWLOWTMCITMI-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.55 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|