C35H21F30NO3 — CID 122376198
3,5-bis[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecoxy)phenyl]-1,2-oxazole (PubChem CID 122376198) has the molecular formula C35H21F30NO3 and a molecular weight of 1073.50 g/mol. Its IUPAC name is 3,5-bis[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecoxy)phenyl]-1,2-oxazole.
| Compound Name | 3,5-bis[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecoxy)phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 122376198 |
| Molecular Formula | C35H21F30NO3 |
| Molecular Weight | 1073.50 g/mol |
| Exact Mass | 1073.10 |
| IUPAC Name | 3,5-bis[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecoxy)phenyl]-1,2-oxazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCOc1ccc(-c2cc(-c3ccc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc3)on2)cc1 |
| InChI | InChI=1S/C35H21F30NO3/c36-22(37,24(40,41)26(44,45)28(48,49)30(52,53)32(56,57)34(60,61)62)11-1-13-67-18-7-3-16(4-8-18)20-15-21(69-66-20)17-5-9-19(10-6-17)68-14-2-12-23(38,39)25(42,43)27(46,47)29(50,51)31(54,55)33(58,59)35(63,64)65/h3-10,15H,1-2,11-14H2 |
| InChIKey | LKJUXZXCVYJXPV-UHFFFAOYSA-N |
| XLogP | 15.07 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1073.50 |
| LogP ≤ 5 | 15.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|