C12H8BrF9O — CID 98455863
1-bromo-4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)benzene (PubChem CID 98455863) has the molecular formula C12H8BrF9O and a molecular weight of 419.08 g/mol. Its IUPAC name is 1-bromo-4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)benzene.
| Compound Name | 1-bromo-4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)benzene |
|---|---|
| PubChem CID | 98455863 |
| Molecular Formula | C12H8BrF9O |
| Molecular Weight | 419.08 g/mol |
| Exact Mass | 417.96 |
| IUPAC Name | 1-bromo-4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H8BrF9O/c13-7-1-3-8(4-2-7)23-6-5-9(14,15)10(16,17)11(18,19)12(20,21)22/h1-4H,5-6H2 |
| InChIKey | HPJCEFIINVJLND-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.08 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|