C14H9F13O2 — CID 18448872
2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)phenol (PubChem CID 18448872) has the molecular formula C14H9F13O2 and a molecular weight of 456.20 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)phenol.
| Compound Name | 2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)phenol |
|---|---|
| PubChem CID | 18448872 |
| Molecular Formula | C14H9F13O2 |
| Molecular Weight | 456.20 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)phenol |
| SMILES | Oc1ccccc1OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H9F13O2/c15-9(16,5-6-29-8-4-2-1-3-7(8)28)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h1-4,28H,5-6H2 |
| InChIKey | MSKUFSNPMWXSLH-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.20 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|