C18H13F9O2 — CID 22465771
4-[4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)phenyl]phenol (PubChem CID 22465771) has the molecular formula C18H13F9O2 and a molecular weight of 432.28 g/mol. Its IUPAC name is 4-[4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)phenyl]phenol.
| Compound Name | 4-[4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)phenyl]phenol |
|---|---|
| PubChem CID | 22465771 |
| Molecular Formula | C18H13F9O2 |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 4-[4-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)phenyl]phenol |
| SMILES | Oc1ccc(-c2ccc(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H13F9O2/c19-15(20,16(21,22)17(23,24)18(25,26)27)9-10-29-14-7-3-12(4-8-14)11-1-5-13(28)6-2-11/h1-8,28H,9-10H2 |
| InChIKey | ULZYMTLUIODWFF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|