C22H17F13O2 — CID 88959663
[4-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)phenyl]phenyl]methanol (PubChem CID 88959663) has the molecular formula C22H17F13O2 and a molecular weight of 560.35 g/mol. Its IUPAC name is [4-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)phenyl]phenyl]methanol.
| Compound Name | [4-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)phenyl]phenyl]methanol |
|---|---|
| PubChem CID | 88959663 |
| Molecular Formula | C22H17F13O2 |
| Molecular Weight | 560.35 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | [4-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxymethyl)phenyl]phenyl]methanol |
| SMILES | OCc1ccc(-c2ccc(COCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H17F13O2/c23-17(24,18(25,26)19(27,28)20(29,30)21(31,32)22(33,34)35)9-10-37-12-14-3-7-16(8-4-14)15-5-1-13(11-36)2-6-15/h1-8,36H,9-12H2 |
| InChIKey | LZOIYMCYFDSWFW-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.35 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|