C15H11F13O — CID 86232636
4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxybenzene (PubChem CID 86232636) has the molecular formula C15H11F13O and a molecular weight of 454.23 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxybenzene.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxybenzene |
|---|---|
| PubChem CID | 86232636 |
| Molecular Formula | C15H11F13O |
| Molecular Weight | 454.23 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxybenzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCOc1ccccc1 |
| InChI | InChI=1S/C15H11F13O/c16-10(17,7-4-8-29-9-5-2-1-3-6-9)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h1-3,5-6H,4,7-8H2 |
| InChIKey | XGRQKZQQHZMPCR-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.23 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|