C42H24F34N2O3 — CID 102527488
2-[bis[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]methylideneamino]oxybenzonitrile (PubChem CID 102527488) has the molecular formula C42H24F34N2O3 and a molecular weight of 1250.60 g/mol. Its IUPAC name is 2-[bis[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]methylideneamino]oxybenzonitrile.
| Compound Name | 2-[bis[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]methylideneamino]oxybenzonitrile |
|---|---|
| PubChem CID | 102527488 |
| Molecular Formula | C42H24F34N2O3 |
| Molecular Weight | 1250.60 g/mol |
| Exact Mass | 1250.12 |
| IUPAC Name | 2-[bis[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)phenyl]methylideneamino]oxybenzonitrile |
| SMILES | N#Cc1ccccc1ON=C(c1ccc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1)c1ccc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C42H24F34N2O3/c43-27(44,29(47,48)31(51,52)33(55,56)35(59,60)37(63,64)39(67,68)41(71,72)73)15-3-17-79-23-11-7-20(8-12-23)26(78-81-25-6-2-1-5-22(25)19-77)21-9-13-24(14-10-21)80-18-4-16-28(45,46)30(49,50)32(53,54)34(57,58)36(61,62)38(65,66)40(69,70)42(74,75)76/h1-2,5-14H,3-4,15-18H2 |
| InChIKey | YKIYRRXURMSQTM-UHFFFAOYSA-N |
| XLogP | 16.73 |
| TPSA | 63.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1250.60 |
| LogP ≤ 5 | 16.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|