C27H17F21O3 — CID 15790438
[4-(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-henicosafluorotetradecoxy)-2-hydroxyphenyl]-phenylmethanone (PubChem CID 15790438) has the molecular formula C27H17F21O3 and a molecular weight of 788.39 g/mol. Its IUPAC name is [4-(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-henicosafluorotetradecoxy)-2-hydroxyphenyl]-phenylmethanone.
| Compound Name | [4-(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-henicosafluorotetradecoxy)-2-hydroxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 15790438 |
| Molecular Formula | C27H17F21O3 |
| Molecular Weight | 788.39 g/mol |
| Exact Mass | 788.08 |
| IUPAC Name | [4-(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-henicosafluorotetradecoxy)-2-hydroxyphenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(OCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1O |
| InChI | InChI=1S/C27H17F21O3/c28-18(29,10-4-5-11-51-14-8-9-15(16(49)12-14)17(50)13-6-2-1-3-7-13)19(30,31)20(32,33)21(34,35)22(36,37)23(38,39)24(40,41)25(42,43)26(44,45)27(46,47)48/h1-3,6-9,12,49H,4-5,10-11H2 |
| InChIKey | SMRQUBVXQOHHBY-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.39 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|