C37H25BrF34O2 — CID 102086907
1-(3-bromo-3-phenylpropyl)-3,5-bis(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)benzene (PubChem CID 102086907) has the molecular formula C37H25BrF34O2 and a molecular weight of 1227.44 g/mol. Its IUPAC name is 1-(3-bromo-3-phenylpropyl)-3,5-bis(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)benzene.
| Compound Name | 1-(3-bromo-3-phenylpropyl)-3,5-bis(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)benzene |
|---|---|
| PubChem CID | 102086907 |
| Molecular Formula | C37H25BrF34O2 |
| Molecular Weight | 1227.44 g/mol |
| Exact Mass | 1226.05 |
| IUPAC Name | 1-(3-bromo-3-phenylpropyl)-3,5-bis(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCOc1cc(CCC(Br)c2ccccc2)cc(OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C37H25BrF34O2/c38-21(18-6-2-1-3-7-18)9-8-17-14-19(73-12-4-10-22(39,40)24(43,44)26(47,48)28(51,52)30(55,56)32(59,60)34(63,64)36(67,68)69)16-20(15-17)74-13-5-11-23(41,42)25(45,46)27(49,50)29(53,54)31(57,58)33(61,62)35(65,66)37(70,71)72/h1-3,6-7,14-16,21H,4-5,8-13H2 |
| InChIKey | YBZNIPPTRUWEBR-UHFFFAOYSA-N |
| XLogP | 17.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1227.44 |
| LogP ≤ 5 | 17.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|