C37H42F26O3S — CID 16744834
10-[[3,5-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecoxy)phenyl]methoxy]decane-1-thiol (PubChem CID 16744834) has the molecular formula C37H42F26O3S and a molecular weight of 1060.75 g/mol. Its IUPAC name is 10-[[3,5-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecoxy)phenyl]methoxy]decane-1-thiol.
| Compound Name | 10-[[3,5-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecoxy)phenyl]methoxy]decane-1-thiol |
|---|---|
| PubChem CID | 16744834 |
| Molecular Formula | C37H42F26O3S |
| Molecular Weight | 1060.75 g/mol |
| Exact Mass | 1060.24 |
| IUPAC Name | 10-[[3,5-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecoxy)phenyl]methoxy]decane-1-thiol |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCOc1cc(COCCCCCCCCCCS)cc(OCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C37H42F26O3S/c38-26(39,28(42,43)30(46,47)32(50,51)34(54,55)36(58,59)60)13-7-10-16-65-24-19-23(22-64-15-9-5-3-1-2-4-6-12-18-67)20-25(21-24)66-17-11-8-14-27(40,41)29(44,45)31(48,49)33(52,53)35(56,57)37(61,62)63/h19-21,67H,1-18,22H2 |
| InChIKey | VBFXEYIJMODUDU-UHFFFAOYSA-N |
| XLogP | 15.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1060.75 |
| LogP ≤ 5 | 15.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|