C31H55BrO11 — CID 54771674
1-(6-bromohexoxymethyl)-3,5-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]benzene (PubChem CID 54771674) has the molecular formula C31H55BrO11 and a molecular weight of 683.67 g/mol. Its IUPAC name is 1-(6-bromohexoxymethyl)-3,5-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]benzene.
| Compound Name | 1-(6-bromohexoxymethyl)-3,5-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]benzene |
|---|---|
| PubChem CID | 54771674 |
| Molecular Formula | C31H55BrO11 |
| Molecular Weight | 683.67 g/mol |
| Exact Mass | 682.29 |
| IUPAC Name | 1-(6-bromohexoxymethyl)-3,5-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]benzene |
| SMILES | COCCOCCOCCOCCOc1cc(COCCCCCCBr)cc(OCCOCCOCCOCCOC)c1 |
| InChI | InChI=1S/C31H55BrO11/c1-33-9-11-35-13-15-37-17-19-39-21-23-42-30-25-29(28-41-8-6-4-3-5-7-32)26-31(27-30)43-24-22-40-20-18-38-16-14-36-12-10-34-2/h25-27H,3-24,28H2,1-2H3 |
| InChIKey | NMYJHKYGOBBLPW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.67 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|