C16H25BrO2 — CID 23045318
4-[2-(6-bromohexoxy)ethoxy]-1,2-dimethylbenzene (PubChem CID 23045318) has the molecular formula C16H25BrO2 and a molecular weight of 329.28 g/mol. Its IUPAC name is 4-[2-(6-bromohexoxy)ethoxy]-1,2-dimethylbenzene.
| Compound Name | 4-[2-(6-bromohexoxy)ethoxy]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 23045318 |
| Molecular Formula | C16H25BrO2 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 4-[2-(6-bromohexoxy)ethoxy]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(OCCOCCCCCCBr)cc1C |
| InChI | InChI=1S/C16H25BrO2/c1-14-7-8-16(13-15(14)2)19-12-11-18-10-6-4-3-5-9-17/h7-8,13H,3-6,9-12H2,1-2H3 |
| InChIKey | MPJYNWLQTJLNMG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|