C11H15ClO — CID 16788005
4-(3-chloropropoxy)-1,2-dimethylbenzene (PubChem CID 16788005) has the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. Its IUPAC name is 4-(3-chloropropoxy)-1,2-dimethylbenzene.
| Compound Name | 4-(3-chloropropoxy)-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 16788005 |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 4-(3-chloropropoxy)-1,2-dimethylbenzene |
| SMILES | Cc1ccc(OCCCCl)cc1C |
| InChI | InChI=1S/C11H15ClO/c1-9-4-5-11(8-10(9)2)13-7-3-6-12/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | KTYIRUDAFDWGFB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|